C10H16N2O6S2 — CID 66062767
4-(1,1-dioxothian-4-yl)sulfonyl-3-methylpiperazine-2,6-dione (PubChem CID 66062767) has the molecular formula C10H16N2O6S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-(1,1-dioxothian-4-yl)sulfonyl-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(1,1-dioxothian-4-yl)sulfonyl-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66062767 |
| Molecular Formula | C10H16N2O6S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-(1,1-dioxothian-4-yl)sulfonyl-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1S(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H16N2O6S2/c1-7-10(14)11-9(13)6-12(7)20(17,18)8-2-4-19(15,16)5-3-8/h7-8H,2-6H2,1H3,(H,11,13,14) |
| InChIKey | QLVMQZCHUNZAIM-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|