C22H20F17NO3 — CID 11342838
4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl (2R)-2-[(4-methoxyphenyl)methylamino]propanoate (PubChem CID 11342838) has the molecular formula C22H20F17NO3 and a molecular weight of 669.37 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl (2R)-2-[(4-methoxyphenyl)methylamino]propanoate.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl (2R)-2-[(4-methoxyphenyl)methylamino]propanoate |
|---|---|
| PubChem CID | 11342838 |
| Molecular Formula | C22H20F17NO3 |
| Molecular Weight | 669.37 g/mol |
| Exact Mass | 669.12 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl (2R)-2-[(4-methoxyphenyl)methylamino]propanoate |
| SMILES | COc1ccc(CN[C@H](C)C(=O)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H20F17NO3/c1-11(40-10-12-4-6-13(42-2)7-5-12)14(41)43-9-3-8-15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)21(35,36)22(37,38)39/h4-7,11,40H,3,8-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | FMIAEXZHANQOAP-LLVKDONJSA-N |
| XLogP | 7.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.37 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|