C9H13NO — CID 11344107
(E)-8-hydroxy-6-methylideneoct-4-enenitrile (PubChem CID 11344107) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (E)-8-hydroxy-6-methylideneoct-4-enenitrile.
| Compound Name | (E)-8-hydroxy-6-methylideneoct-4-enenitrile |
|---|---|
| PubChem CID | 11344107 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (E)-8-hydroxy-6-methylideneoct-4-enenitrile |
| SMILES | C=C(/C=C/CCC#N)CCO |
| InChI | InChI=1S/C9H13NO/c1-9(6-8-11)5-3-2-4-7-10/h3,5,11H,1-2,4,6,8H2/b5-3+ |
| InChIKey | WVWHTIUSSWIYQC-HWKANZROSA-N |
| XLogP | 1.78 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|