C14H15NO — CID 143426131
(2E,5Z)-7-(hydroxymethyl)-3,4-dimethylidene-2-prop-2-enylideneocta-5,7-dienenitrile (PubChem CID 143426131) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is (2E,5Z)-7-(hydroxymethyl)-3,4-dimethylidene-2-prop-2-enylideneocta-5,7-dienenitrile.
| Compound Name | (2E,5Z)-7-(hydroxymethyl)-3,4-dimethylidene-2-prop-2-enylideneocta-5,7-dienenitrile |
|---|---|
| PubChem CID | 143426131 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (2E,5Z)-7-(hydroxymethyl)-3,4-dimethylidene-2-prop-2-enylideneocta-5,7-dienenitrile |
| SMILES | C=C/C=C(/C#N)C(=C)C(=C)/C=C\C(=C)CO |
| InChI | InChI=1S/C14H15NO/c1-5-6-14(9-15)13(4)12(3)8-7-11(2)10-16/h5-8,16H,1-4,10H2/b8-7-,14-6- |
| InChIKey | QWGZHIKGPIKKIX-NYOKVFCBSA-N |
| XLogP | 2.84 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|