C21H24N2O3S2 — CID 1134507
[(4'R,6S)-4,4,8'-trimethyl-2-sulfanylidene-4'-thiophen-2-ylspiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-7'-yl] acetate (PubChem CID 1134507) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is [(4'R,6S)-4,4,8'-trimethyl-2-sulfanylidene-4'-thiophen-2-ylspiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-7'-yl] acetate.
| Compound Name | [(4'R,6S)-4,4,8'-trimethyl-2-sulfanylidene-4'-thiophen-2-ylspiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-7'-yl] acetate |
|---|---|
| PubChem CID | 1134507 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [(4'R,6S)-4,4,8'-trimethyl-2-sulfanylidene-4'-thiophen-2-ylspiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-7'-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1C)O[C@@]1(C[C@H]2c2cccs2)CC(C)(C)NC(=S)N1 |
| InChI | InChI=1S/C21H24N2O3S2/c1-12-16(25-13(2)24)8-7-14-15(17-6-5-9-28-17)10-21(26-18(12)14)11-20(3,4)22-19(27)23-21/h5-9,15H,10-11H2,1-4H3,(H2,22,23,27)/t15-,21+/m1/s1 |
| InChIKey | YIEBLMFYBKLGST-VFNWGFHPSA-N |
| XLogP | 4.24 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|