C18H19ClN2O2S2 — CID 983799
(4'S,6S)-6'-chloro-7'-hydroxy-4,4-dimethyl-4'-thiophen-2-ylspiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-thione (PubChem CID 983799) has the molecular formula C18H19ClN2O2S2 and a molecular weight of 394.95 g/mol. Its IUPAC name is (4'S,6S)-6'-chloro-7'-hydroxy-4,4-dimethyl-4'-thiophen-2-ylspiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-thione.
| Compound Name | (4'S,6S)-6'-chloro-7'-hydroxy-4,4-dimethyl-4'-thiophen-2-ylspiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-thione |
|---|---|
| PubChem CID | 983799 |
| Molecular Formula | C18H19ClN2O2S2 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | (4'S,6S)-6'-chloro-7'-hydroxy-4,4-dimethyl-4'-thiophen-2-ylspiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-thione |
| SMILES | CC1(C)C[C@@]2(C[C@H](c3cccs3)c3cc(Cl)c(O)cc3O2)NC(=S)N1 |
| InChI | InChI=1S/C18H19ClN2O2S2/c1-17(2)9-18(21-16(24)20-17)8-11(15-4-3-5-25-15)10-6-12(19)13(22)7-14(10)23-18/h3-7,11,22H,8-9H2,1-2H3,(H2,20,21,24)/t11-,18-/m0/s1 |
| InChIKey | KTLBDBUVOUICSC-VOJFVSQTSA-N |
| XLogP | 4.36 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|