C22H26N2O2S — CID 1139267
(4'S,6S)-7'-hydroxy-4,4,5'-trimethyl-4'-(3-methylphenyl)spiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-thione (PubChem CID 1139267) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is (4'S,6S)-7'-hydroxy-4,4,5'-trimethyl-4'-(3-methylphenyl)spiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-thione.
| Compound Name | (4'S,6S)-7'-hydroxy-4,4,5'-trimethyl-4'-(3-methylphenyl)spiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-thione |
|---|---|
| PubChem CID | 1139267 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (4'S,6S)-7'-hydroxy-4,4,5'-trimethyl-4'-(3-methylphenyl)spiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-thione |
| SMILES | Cc1cccc([C@@H]2C[C@@]3(CC(C)(C)NC(=S)N3)Oc3cc(O)cc(C)c32)c1 |
| InChI | InChI=1S/C22H26N2O2S/c1-13-6-5-7-15(8-13)17-11-22(12-21(3,4)23-20(27)24-22)26-18-10-16(25)9-14(2)19(17)18/h5-10,17,25H,11-12H2,1-4H3,(H2,23,24,27)/t17-,22-/m0/s1 |
| InChIKey | AJDISCJAOFSJGQ-JTSKRJEESA-N |
| XLogP | 4.27 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|