C20H21ClN2O3 — CID 1142235
(4'S,6R)-4'-(2-chlorophenyl)-7'-hydroxy-4,4-dimethylspiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-one (PubChem CID 1142235) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is (4'S,6R)-4'-(2-chlorophenyl)-7'-hydroxy-4,4-dimethylspiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-one.
| Compound Name | (4'S,6R)-4'-(2-chlorophenyl)-7'-hydroxy-4,4-dimethylspiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-one |
|---|---|
| PubChem CID | 1142235 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (4'S,6R)-4'-(2-chlorophenyl)-7'-hydroxy-4,4-dimethylspiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-2-one |
| SMILES | CC1(C)C[C@]2(C[C@H](c3ccccc3Cl)c3ccc(O)cc3O2)NC(=O)N1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-19(2)11-20(23-18(25)22-19)10-15(13-5-3-4-6-16(13)21)14-8-7-12(24)9-17(14)26-20/h3-9,15,24H,10-11H2,1-2H3,(H2,22,23,25)/t15-,20-/m1/s1 |
| InChIKey | USVAGCPQMZRPOS-FOIQADDNSA-N |
| XLogP | 4.14 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |