C21H23ClN2O2S — CID 7119980
(4R,4'S)-4'-(2-chlorophenyl)-6,6-dimethyl-2-methylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol (PubChem CID 7119980) has the molecular formula C21H23ClN2O2S and a molecular weight of 402.95 g/mol. Its IUPAC name is (4R,4'S)-4'-(2-chlorophenyl)-6,6-dimethyl-2-methylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol.
| Compound Name | (4R,4'S)-4'-(2-chlorophenyl)-6,6-dimethyl-2-methylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol |
|---|---|
| PubChem CID | 7119980 |
| Molecular Formula | C21H23ClN2O2S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (4R,4'S)-4'-(2-chlorophenyl)-6,6-dimethyl-2-methylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol |
| SMILES | CSC1=N[C@@]2(C[C@H](c3ccccc3Cl)c3ccc(O)cc3O2)CC(C)(C)N1 |
| InChI | InChI=1S/C21H23ClN2O2S/c1-20(2)12-21(24-19(23-20)27-3)11-16(14-6-4-5-7-17(14)22)15-9-8-13(25)10-18(15)26-21/h4-10,16,25H,11-12H2,1-3H3,(H,23,24)/t16-,21-/m1/s1 |
| InChIKey | CRBODCHBJXULHB-IIBYNOLFSA-N |
| XLogP | 5.15 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |