C23H28N2O2S — CID 7116406
(4R,4'S)-6,6,8'-trimethyl-4'-(4-methylphenyl)-2-methylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol (PubChem CID 7116406) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is (4R,4'S)-6,6,8'-trimethyl-4'-(4-methylphenyl)-2-methylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol.
| Compound Name | (4R,4'S)-6,6,8'-trimethyl-4'-(4-methylphenyl)-2-methylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol |
|---|---|
| PubChem CID | 7116406 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (4R,4'S)-6,6,8'-trimethyl-4'-(4-methylphenyl)-2-methylsulfanylspiro[1,5-dihydropyrimidine-4,2'-3,4-dihydrochromene]-7'-ol |
| SMILES | CSC1=N[C@@]2(C[C@@H](c3ccc(C)cc3)c3ccc(O)c(C)c3O2)CC(C)(C)N1 |
| InChI | InChI=1S/C23H28N2O2S/c1-14-6-8-16(9-7-14)18-12-23(13-22(3,4)24-21(25-23)28-5)27-20-15(2)19(26)11-10-17(18)20/h6-11,18,26H,12-13H2,1-5H3,(H,24,25)/t18-,23+/m0/s1 |
| InChIKey | ZCXFKROWUYZVOB-FDDCHVKYSA-N |
| XLogP | 5.11 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |