C11H12O3 — CID 15517821
7-hydroxy-4,8-dimethyl-3,4-dihydrochromen-2-one (PubChem CID 15517821) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 7-hydroxy-4,8-dimethyl-3,4-dihydrochromen-2-one.
| Compound Name | 7-hydroxy-4,8-dimethyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 15517821 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 7-hydroxy-4,8-dimethyl-3,4-dihydrochromen-2-one |
| SMILES | Cc1c(O)ccc2c1OC(=O)CC2C |
| InChI | InChI=1S/C11H12O3/c1-6-5-10(13)14-11-7(2)9(12)4-3-8(6)11/h3-4,6,12H,5H2,1-2H3 |
| InChIKey | VLCWLHFIUJAALH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|