C13H14N2O3 — CID 10444586
7-hydroxy-1,3,6-trimethyl-3a,9b-dihydrochromeno[3,4-c]pyrazol-4-one (PubChem CID 10444586) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 7-hydroxy-1,3,6-trimethyl-3a,9b-dihydrochromeno[3,4-c]pyrazol-4-one.
| Compound Name | 7-hydroxy-1,3,6-trimethyl-3a,9b-dihydrochromeno[3,4-c]pyrazol-4-one |
|---|---|
| PubChem CID | 10444586 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 7-hydroxy-1,3,6-trimethyl-3a,9b-dihydrochromeno[3,4-c]pyrazol-4-one |
| SMILES | CC1=NN(C)C2C(=O)Oc3c(ccc(O)c3C)C12 |
| InChI | InChI=1S/C13H14N2O3/c1-6-9(16)5-4-8-10-7(2)14-15(3)11(10)13(17)18-12(6)8/h4-5,10-11,16H,1-3H3 |
| InChIKey | WNYNDDRLIMDWGV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|