C24H26O6 — CID 11647219
(6-acetyloxy-12-hydroxy-13,16,16-trimethyl-15-oxatetracyclo[8.7.1.02,7.014,18]octadeca-2(7),3,5,10,12,14(18)-hexaen-5-yl) acetate (PubChem CID 11647219) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is (6-acetyloxy-12-hydroxy-13,16,16-trimethyl-15-oxatetracyclo[8.7.1.02,7.014,18]octadeca-2(7),3,5,10,12,14(18)-hexaen-5-yl) acetate.
| Compound Name | (6-acetyloxy-12-hydroxy-13,16,16-trimethyl-15-oxatetracyclo[8.7.1.02,7.014,18]octadeca-2(7),3,5,10,12,14(18)-hexaen-5-yl) acetate |
|---|---|
| PubChem CID | 11647219 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (6-acetyloxy-12-hydroxy-13,16,16-trimethyl-15-oxatetracyclo[8.7.1.02,7.014,18]octadeca-2(7),3,5,10,12,14(18)-hexaen-5-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(c1OC(C)=O)CCc1cc(O)c(C)c3c1C2CC(C)(C)O3 |
| InChI | InChI=1S/C24H26O6/c1-12-19(27)10-15-6-7-17-16(18-11-24(4,5)30-22(12)21(15)18)8-9-20(28-13(2)25)23(17)29-14(3)26/h8-10,18,27H,6-7,11H2,1-5H3 |
| InChIKey | LHBJOJFIMFTZCP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|