C20H22O5 — CID 162917935
13,16,16-trimethyl-15-oxatetracyclo[8.7.1.02,7.014,18]octadeca-2(7),3,5,10,12,14(18)-hexaene-5,6,12,17-tetrol (PubChem CID 162917935) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is 13,16,16-trimethyl-15-oxatetracyclo[8.7.1.02,7.014,18]octadeca-2(7),3,5,10,12,14(18)-hexaene-5,6,12,17-tetrol.
| Compound Name | 13,16,16-trimethyl-15-oxatetracyclo[8.7.1.02,7.014,18]octadeca-2(7),3,5,10,12,14(18)-hexaene-5,6,12,17-tetrol |
|---|---|
| PubChem CID | 162917935 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 13,16,16-trimethyl-15-oxatetracyclo[8.7.1.02,7.014,18]octadeca-2(7),3,5,10,12,14(18)-hexaene-5,6,12,17-tetrol |
| SMILES | Cc1c(O)cc2c3c1OC(C)(C)C(O)C3c1ccc(O)c(O)c1CC2 |
| InChI | InChI=1S/C20H22O5/c1-9-14(22)8-10-4-5-12-11(6-7-13(21)17(12)23)16-15(10)18(9)25-20(2,3)19(16)24/h6-8,16,19,21-24H,4-5H2,1-3H3 |
| InChIKey | DHRCRPRUHZMPFM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|