C12H18N2O5 — CID 113450709
2-[(3-methoxyoxolan-3-yl)methylcarbamoylamino]pent-4-ynoic acid (PubChem CID 113450709) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-[(3-methoxyoxolan-3-yl)methylcarbamoylamino]pent-4-ynoic acid.
| Compound Name | 2-[(3-methoxyoxolan-3-yl)methylcarbamoylamino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 113450709 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[(3-methoxyoxolan-3-yl)methylcarbamoylamino]pent-4-ynoic acid |
| SMILES | C#CCC(NC(=O)NCC1(OC)CCOC1)C(=O)O |
| InChI | InChI=1S/C12H18N2O5/c1-3-4-9(10(15)16)14-11(17)13-7-12(18-2)5-6-19-8-12/h1,9H,4-8H2,2H3,(H,15,16)(H2,13,14,17) |
| InChIKey | FHGASHKDPQCJLV-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|