C16H24O8 — CID 11348491
ethyl (1S,2R,6R,8R,10S)-10-(2-ethoxy-2-oxoethyl)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate (PubChem CID 11348491) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is ethyl (1S,2R,6R,8R,10S)-10-(2-ethoxy-2-oxoethyl)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate.
| Compound Name | ethyl (1S,2R,6R,8R,10S)-10-(2-ethoxy-2-oxoethyl)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate |
|---|---|
| PubChem CID | 11348491 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | ethyl (1S,2R,6R,8R,10S)-10-(2-ethoxy-2-oxoethyl)-4,4-dimethyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10-carboxylate |
| SMILES | CCOC(=O)C[C@]1(C(=O)OCC)C[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C16H24O8/c1-5-19-10(17)8-16(14(18)20-6-2)7-9-11(23-16)12-13(21-9)24-15(3,4)22-12/h9,11-13H,5-8H2,1-4H3/t9-,11+,12-,13-,16+/m1/s1 |
| InChIKey | MQTHRABSLZFZNO-NDPRJGJWSA-N |
| XLogP | 0.91 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |