C17H20ClN3O3 — CID 11348658
ethyl 3-(3-chloropropylcarbamoylamino)-5-phenyl-1H-pyrrole-2-carboxylate (PubChem CID 11348658) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is ethyl 3-(3-chloropropylcarbamoylamino)-5-phenyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-(3-chloropropylcarbamoylamino)-5-phenyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 11348658 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | ethyl 3-(3-chloropropylcarbamoylamino)-5-phenyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(-c2ccccc2)cc1NC(=O)NCCCCl |
| InChI | InChI=1S/C17H20ClN3O3/c1-2-24-16(22)15-14(21-17(23)19-10-6-9-18)11-13(20-15)12-7-4-3-5-8-12/h3-5,7-8,11,20H,2,6,9-10H2,1H3,(H2,19,21,23) |
| InChIKey | ZSRFPEJLVKPVMO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|