C25H40O6Si — CID 11351757
[tert-butyl(dimethyl)silyl] (Z)-5-[(1S,2R,6R)-2-acetyloxy-6-[(E)-4-oxopent-2-en-2-yl]cyclohexyl]-2-methyl-4-oxopent-2-enoate (PubChem CID 11351757) has the molecular formula C25H40O6Si and a molecular weight of 464.68 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (Z)-5-[(1S,2R,6R)-2-acetyloxy-6-[(E)-4-oxopent-2-en-2-yl]cyclohexyl]-2-methyl-4-oxopent-2-enoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (Z)-5-[(1S,2R,6R)-2-acetyloxy-6-[(E)-4-oxopent-2-en-2-yl]cyclohexyl]-2-methyl-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 11351757 |
| Molecular Formula | C25H40O6Si |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (Z)-5-[(1S,2R,6R)-2-acetyloxy-6-[(E)-4-oxopent-2-en-2-yl]cyclohexyl]-2-methyl-4-oxopent-2-enoate |
| SMILES | CC(=O)/C=C(\C)[C@@H]1CCC[C@@H](OC(C)=O)[C@H]1CC(=O)/C=C(/C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40O6Si/c1-16(13-18(3)26)21-11-10-12-23(30-19(4)27)22(21)15-20(28)14-17(2)24(29)31-32(8,9)25(5,6)7/h13-14,21-23H,10-12,15H2,1-9H3/b16-13+,17-14-/t21-,22-,23+/m0/s1 |
| InChIKey | GCRKWZBQONPJEC-MQGIFELESA-N |
| XLogP | 5.32 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|