C24H40O4Si — CID 10477249
ethyl (E)-3-[(3R,4S,4aS,5S,7S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-formyl-3,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]prop-2-enoate (PubChem CID 10477249) has the molecular formula C24H40O4Si and a molecular weight of 420.67 g/mol. Its IUPAC name is ethyl (E)-3-[(3R,4S,4aS,5S,7S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-formyl-3,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3R,4S,4aS,5S,7S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-formyl-3,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10477249 |
| Molecular Formula | C24H40O4Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | ethyl (E)-3-[(3R,4S,4aS,5S,7S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-4-formyl-3,7-dimethyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1=C[C@H]2C[C@H](C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2[C@@H](C=O)[C@H]1C |
| InChI | InChI=1S/C24H40O4Si/c1-9-27-22(26)11-10-18-14-19-12-16(2)13-21(23(19)20(15-25)17(18)3)28-29(7,8)24(4,5)6/h10-11,14-17,19-21,23H,9,12-13H2,1-8H3/b11-10+/t16-,17-,19+,20-,21-,23-/m0/s1 |
| InChIKey | HKDFLCOEODBXRK-GSGIXCKMSA-N |
| XLogP | 5.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|