C27H44O6Si — CID 90894743
methyl 5-[(1S,2R,4R,6R)-2-acetyloxy-6-[4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]-4-methylcyclohexyl]-2-methyl-4-oxopent-2-enoate (PubChem CID 90894743) has the molecular formula C27H44O6Si and a molecular weight of 492.73 g/mol. Its IUPAC name is methyl 5-[(1S,2R,4R,6R)-2-acetyloxy-6-[4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]-4-methylcyclohexyl]-2-methyl-4-oxopent-2-enoate.
| Compound Name | methyl 5-[(1S,2R,4R,6R)-2-acetyloxy-6-[4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]-4-methylcyclohexyl]-2-methyl-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 90894743 |
| Molecular Formula | C27H44O6Si |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | methyl 5-[(1S,2R,4R,6R)-2-acetyloxy-6-[4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]-4-methylcyclohexyl]-2-methyl-4-oxopent-2-enoate |
| SMILES | C=C(C=C(C)[C@@H]1C[C@@H](C)C[C@@H](OC(C)=O)[C@H]1CC(=O)C=C(C)C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H44O6Si/c1-17-12-23(18(2)14-20(4)33-34(10,11)27(6,7)8)24(25(13-17)32-21(5)28)16-22(29)15-19(3)26(30)31-9/h14-15,17,23-25H,4,12-13,16H2,1-3,5-11H3/t17-,23+,24+,25-/m1/s1 |
| InChIKey | DDWQRQVWCZBIOK-XLRUWRGTSA-N |
| XLogP | 6.14 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|