C26H42O6Si — CID 11190790
methyl (Z)-5-[(1S,2R,6R)-2-acetyloxy-6-[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]cyclohexyl]-2-methyl-4-oxopent-2-enoate (PubChem CID 11190790) has the molecular formula C26H42O6Si and a molecular weight of 478.70 g/mol. Its IUPAC name is methyl (Z)-5-[(1S,2R,6R)-2-acetyloxy-6-[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]cyclohexyl]-2-methyl-4-oxopent-2-enoate.
| Compound Name | methyl (Z)-5-[(1S,2R,6R)-2-acetyloxy-6-[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]cyclohexyl]-2-methyl-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 11190790 |
| Molecular Formula | C26H42O6Si |
| Molecular Weight | 478.70 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | methyl (Z)-5-[(1S,2R,6R)-2-acetyloxy-6-[(2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]cyclohexyl]-2-methyl-4-oxopent-2-enoate |
| SMILES | C=C(/C=C(\C)[C@@H]1CCC[C@@H](OC(C)=O)[C@H]1CC(=O)/C=C(/C)C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H42O6Si/c1-17(14-19(3)32-33(9,10)26(5,6)7)22-12-11-13-24(31-20(4)27)23(22)16-21(28)15-18(2)25(29)30-8/h14-15,22-24H,3,11-13,16H2,1-2,4-10H3/b17-14+,18-15-/t22-,23-,24+/m0/s1 |
| InChIKey | LYDGJVWUPALOPV-MPAZDJIBSA-N |
| XLogP | 5.89 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|