C16H28O2 — CID 11357212
(1R,4R)-4-hydroxy-1,4,7,7,9,9-hexamethylspiro[4.5]decan-3-one (PubChem CID 11357212) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (1R,4R)-4-hydroxy-1,4,7,7,9,9-hexamethylspiro[4.5]decan-3-one.
| Compound Name | (1R,4R)-4-hydroxy-1,4,7,7,9,9-hexamethylspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 11357212 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (1R,4R)-4-hydroxy-1,4,7,7,9,9-hexamethylspiro[4.5]decan-3-one |
| SMILES | C[C@@H]1CC(=O)[C@](C)(O)C12CC(C)(C)CC(C)(C)C2 |
| InChI | InChI=1S/C16H28O2/c1-11-7-12(17)15(6,18)16(11)9-13(2,3)8-14(4,5)10-16/h11,18H,7-10H2,1-6H3/t11-,15+/m1/s1 |
| InChIKey | DLFATRPSUKNSKP-ABAIWWIYSA-N |
| XLogP | 3.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |