C16H15F2N5O5 — CID 11361425
(2R,3R,4S,5R)-2-[6-amino-2-(2,4-difluorophenoxy)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 11361425) has the molecular formula C16H15F2N5O5 and a molecular weight of 395.32 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-amino-2-(2,4-difluorophenoxy)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-amino-2-(2,4-difluorophenoxy)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 11361425 |
| Molecular Formula | C16H15F2N5O5 |
| Molecular Weight | 395.32 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-amino-2-(2,4-difluorophenoxy)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(Oc2ccc(F)cc2F)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H15F2N5O5/c17-6-1-2-8(7(18)3-6)28-16-21-13(19)10-14(22-16)23(5-20-10)15-12(26)11(25)9(4-24)27-15/h1-3,5,9,11-12,15,24-26H,4H2,(H2,19,21,22)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | WOIJNENCPOALBK-SDBHATRESA-N |
| XLogP | 0.09 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |