C16H16F2N5O4P — CID 143600583
(2R,3R,4R,5R)-5-[6-amino-2-(3,4-difluorophenoxy)purin-9-yl]-2-(hydroxymethyl)-4-phosphanyloxolan-3-ol (PubChem CID 143600583) has the molecular formula C16H16F2N5O4P and a molecular weight of 411.31 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-[6-amino-2-(3,4-difluorophenoxy)purin-9-yl]-2-(hydroxymethyl)-4-phosphanyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-[6-amino-2-(3,4-difluorophenoxy)purin-9-yl]-2-(hydroxymethyl)-4-phosphanyloxolan-3-ol |
|---|---|
| PubChem CID | 143600583 |
| Molecular Formula | C16H16F2N5O4P |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (2R,3R,4R,5R)-5-[6-amino-2-(3,4-difluorophenoxy)purin-9-yl]-2-(hydroxymethyl)-4-phosphanyloxolan-3-ol |
| SMILES | Nc1nc(Oc2ccc(F)c(F)c2)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1P |
| InChI | InChI=1S/C16H16F2N5O4P/c17-7-2-1-6(3-8(7)18)26-16-21-13(19)10-14(22-16)23(5-20-10)15-12(28)11(25)9(4-24)27-15/h1-3,5,9,11-12,15,24-25H,4,28H2,(H2,19,21,22)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | JNPLLBONVUOLFM-SDBHATRESA-N |
| XLogP | 0.97 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|