C21H27O7PS — CID 11363019
[4-[(E)-4-diethoxyphosphoryloxybut-2-en-2-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 11363019) has the molecular formula C21H27O7PS and a molecular weight of 454.48 g/mol. Its IUPAC name is [4-[(E)-4-diethoxyphosphoryloxybut-2-en-2-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(E)-4-diethoxyphosphoryloxybut-2-en-2-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11363019 |
| Molecular Formula | C21H27O7PS |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [4-[(E)-4-diethoxyphosphoryloxybut-2-en-2-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CCOP(=O)(OCC)OC/C=C(\C)c1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H27O7PS/c1-5-25-29(22,26-6-2)27-16-15-18(4)19-9-11-20(12-10-19)28-30(23,24)21-13-7-17(3)8-14-21/h7-15H,5-6,16H2,1-4H3/b18-15+ |
| InChIKey | BXCLDLRHDGSONG-OBGWFSINSA-N |
| XLogP | 5.36 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|