C24H27FN8O — CID 11363205
3-(3-fluorophenyl)-N-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]triazolo[4,5-d]pyrimidin-5-amine (PubChem CID 11363205) has the molecular formula C24H27FN8O and a molecular weight of 462.53 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]triazolo[4,5-d]pyrimidin-5-amine.
| Compound Name | 3-(3-fluorophenyl)-N-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]triazolo[4,5-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 11363205 |
| Molecular Formula | C24H27FN8O |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 3-(3-fluorophenyl)-N-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]triazolo[4,5-d]pyrimidin-5-amine |
| SMILES | CN1CCN(CCCOc2ccc(Nc3ncc4nnn(-c5cccc(F)c5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C24H27FN8O/c1-31-11-13-32(14-12-31)10-3-15-34-21-8-6-19(7-9-21)27-24-26-17-22-23(28-24)33(30-29-22)20-5-2-4-18(25)16-20/h2,4-9,16-17H,3,10-15H2,1H3,(H,26,27,28) |
| InChIKey | PASWXCPAHIBTRF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|