C25H28F3N3O4 — CID 11363862
7-methoxy-1'-(2-phenoxyethyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-pyrrolidine];2,2,2-trifluoroacetic acid (PubChem CID 11363862) has the molecular formula C25H28F3N3O4 and a molecular weight of 491.51 g/mol. Its IUPAC name is 7-methoxy-1'-(2-phenoxyethyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-pyrrolidine];2,2,2-trifluoroacetic acid.
| Compound Name | 7-methoxy-1'-(2-phenoxyethyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-pyrrolidine];2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11363862 |
| Molecular Formula | C25H28F3N3O4 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 7-methoxy-1'-(2-phenoxyethyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,3'-pyrrolidine];2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc2c3c([nH]c2c1)C1(CCN(CCOc2ccccc2)C1)NCC3.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H27N3O2.C2HF3O2/c1-27-18-7-8-19-20-9-11-24-23(22(20)25-21(19)15-18)10-12-26(16-23)13-14-28-17-5-3-2-4-6-17;3-2(4,5)1(6)7/h2-8,15,24-25H,9-14,16H2,1H3;(H,6,7) |
| InChIKey | FNIMNHGFBHJRDJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |