C31H43NO5 — CID 11364222
N-methoxy-N,2-dimethyl-5-[(2S,3R,6E)-2-methyl-3-phenylmethoxy-6-(2-phenylmethoxyethylidene)oxepan-2-yl]pentanamide (PubChem CID 11364222) has the molecular formula C31H43NO5 and a molecular weight of 509.69 g/mol. Its IUPAC name is N-methoxy-N,2-dimethyl-5-[(2S,3R,6E)-2-methyl-3-phenylmethoxy-6-(2-phenylmethoxyethylidene)oxepan-2-yl]pentanamide.
| Compound Name | N-methoxy-N,2-dimethyl-5-[(2S,3R,6E)-2-methyl-3-phenylmethoxy-6-(2-phenylmethoxyethylidene)oxepan-2-yl]pentanamide |
|---|---|
| PubChem CID | 11364222 |
| Molecular Formula | C31H43NO5 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | N-methoxy-N,2-dimethyl-5-[(2S,3R,6E)-2-methyl-3-phenylmethoxy-6-(2-phenylmethoxyethylidene)oxepan-2-yl]pentanamide |
| SMILES | CON(C)C(=O)C(C)CCC[C@]1(C)OC/C(=C/COCc2ccccc2)CC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H43NO5/c1-25(30(33)32(3)34-4)12-11-20-31(2)29(36-23-27-15-9-6-10-16-27)18-17-28(24-37-31)19-21-35-22-26-13-7-5-8-14-26/h5-10,13-16,19,25,29H,11-12,17-18,20-24H2,1-4H3/b28-19+/t25?,29-,31+/m1/s1 |
| InChIKey | PCORFOGJMPTYCO-UEIKJMORSA-N |
| XLogP | 6.11 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|