C11H17NO — CID 11367347
(5R,8aR)-5-propan-2-yl-5,6,8,8a-tetrahydro-3H-indolizin-7-one (PubChem CID 11367347) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (5R,8aR)-5-propan-2-yl-5,6,8,8a-tetrahydro-3H-indolizin-7-one.
| Compound Name | (5R,8aR)-5-propan-2-yl-5,6,8,8a-tetrahydro-3H-indolizin-7-one |
|---|---|
| PubChem CID | 11367347 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (5R,8aR)-5-propan-2-yl-5,6,8,8a-tetrahydro-3H-indolizin-7-one |
| SMILES | CC(C)[C@H]1CC(=O)C[C@@H]2C=CCN12 |
| InChI | InChI=1S/C11H17NO/c1-8(2)11-7-10(13)6-9-4-3-5-12(9)11/h3-4,8-9,11H,5-7H2,1-2H3/t9-,11+/m0/s1 |
| InChIKey | GWTUPRCTFRLMSM-GXSJLCMTSA-N |
| XLogP | 1.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|