C20H27NO4Si — CID 11372223
(4S,5S)-3-benzyl-4-[(1R)-1-hydroxyprop-2-enyl]-4-[(1S)-1-hydroxy-3-trimethylsilylprop-2-ynyl]-5-methyl-1,3-oxazolidin-2-one (PubChem CID 11372223) has the molecular formula C20H27NO4Si and a molecular weight of 373.53 g/mol. Its IUPAC name is (4S,5S)-3-benzyl-4-[(1R)-1-hydroxyprop-2-enyl]-4-[(1S)-1-hydroxy-3-trimethylsilylprop-2-ynyl]-5-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-3-benzyl-4-[(1R)-1-hydroxyprop-2-enyl]-4-[(1S)-1-hydroxy-3-trimethylsilylprop-2-ynyl]-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11372223 |
| Molecular Formula | C20H27NO4Si |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (4S,5S)-3-benzyl-4-[(1R)-1-hydroxyprop-2-enyl]-4-[(1S)-1-hydroxy-3-trimethylsilylprop-2-ynyl]-5-methyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](O)[C@]1([C@@H](O)C#C[Si](C)(C)C)[C@H](C)OC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H27NO4Si/c1-6-17(22)20(18(23)12-13-26(3,4)5)15(2)25-19(24)21(20)14-16-10-8-7-9-11-16/h6-11,15,17-18,22-23H,1,14H2,2-5H3/t15-,17+,18-,20-/m0/s1 |
| InChIKey | DSFHFCDFEVHPGW-NFBUACBFSA-N |
| XLogP | 2.55 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|