C24H37NO4Si — CID 59254763
(4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-(3-hydroxyprop-1-en-2-yl)-1,3-oxazolidin-2-one (PubChem CID 59254763) has the molecular formula C24H37NO4Si and a molecular weight of 431.65 g/mol. Its IUPAC name is (4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-(3-hydroxyprop-1-en-2-yl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-(3-hydroxyprop-1-en-2-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59254763 |
| Molecular Formula | C24H37NO4Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-(3-hydroxyprop-1-en-2-yl)-1,3-oxazolidin-2-one |
| SMILES | C=C(CO)[C@H]1OC(=O)N(Cc2ccccc2)[C@]1(CO[Si](C)(C)C(C)(C)C)C1CCC1 |
| InChI | InChI=1S/C24H37NO4Si/c1-18(16-26)21-24(20-13-10-14-20,17-28-30(5,6)23(2,3)4)25(22(27)29-21)15-19-11-8-7-9-12-19/h7-9,11-12,20-21,26H,1,10,13-17H2,2-6H3/t21-,24-/m1/s1 |
| InChIKey | SPDBGLMPOQNABR-ZJSXRUAMSA-N |
| XLogP | 5.12 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|