C31H43NO4Si — CID 135032062
(4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-(3-phenylmethoxyprop-1-en-2-yl)-1,3-oxazolidin-2-one (PubChem CID 135032062) has the molecular formula C31H43NO4Si and a molecular weight of 521.77 g/mol. Its IUPAC name is (4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-(3-phenylmethoxyprop-1-en-2-yl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-(3-phenylmethoxyprop-1-en-2-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135032062 |
| Molecular Formula | C31H43NO4Si |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | (4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-(3-phenylmethoxyprop-1-en-2-yl)-1,3-oxazolidin-2-one |
| SMILES | C=C(COCc1ccccc1)[C@H]1OC(=O)N(Cc2ccccc2)[C@]1(CO[Si](C)(C)C(C)(C)C)C1CCC1 |
| InChI | InChI=1S/C31H43NO4Si/c1-24(21-34-22-26-16-11-8-12-17-26)28-31(27-18-13-19-27,23-35-37(5,6)30(2,3)4)32(29(33)36-28)20-25-14-9-7-10-15-25/h7-12,14-17,27-28H,1,13,18-23H2,2-6H3/t28-,31-/m1/s1 |
| InChIKey | NLBOKHFOZCACCI-GRKNLSHJSA-N |
| XLogP | 7.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|