C25H39NO4Si — CID 135032111
(4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-(3-methoxyprop-1-en-2-yl)-1,3-oxazolidin-2-one (PubChem CID 135032111) has the molecular formula C25H39NO4Si and a molecular weight of 445.68 g/mol. Its IUPAC name is (4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-(3-methoxyprop-1-en-2-yl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-(3-methoxyprop-1-en-2-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135032111 |
| Molecular Formula | C25H39NO4Si |
| Molecular Weight | 445.68 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | (4S,5R)-3-benzyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-5-(3-methoxyprop-1-en-2-yl)-1,3-oxazolidin-2-one |
| SMILES | C=C(COC)[C@H]1OC(=O)N(Cc2ccccc2)[C@]1(CO[Si](C)(C)C(C)(C)C)C1CCC1 |
| InChI | InChI=1S/C25H39NO4Si/c1-19(17-28-5)22-25(21-14-11-15-21,18-29-31(6,7)24(2,3)4)26(23(27)30-22)16-20-12-9-8-10-13-20/h8-10,12-13,21-22H,1,11,14-18H2,2-7H3/t22-,25-/m1/s1 |
| InChIKey | CEMSGRLMZXSEHZ-RCZVLFRGSA-N |
| XLogP | 5.77 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.68 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|