C25H39NO3Si — CID 59254797
(4S,5R)-3-benzyl-5-but-1-en-2-yl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-1,3-oxazolidin-2-one (PubChem CID 59254797) has the molecular formula C25H39NO3Si and a molecular weight of 429.68 g/mol. Its IUPAC name is (4S,5R)-3-benzyl-5-but-1-en-2-yl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-benzyl-5-but-1-en-2-yl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59254797 |
| Molecular Formula | C25H39NO3Si |
| Molecular Weight | 429.68 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | (4S,5R)-3-benzyl-5-but-1-en-2-yl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-cyclobutyl-1,3-oxazolidin-2-one |
| SMILES | C=C(CC)[C@H]1OC(=O)N(Cc2ccccc2)[C@]1(CO[Si](C)(C)C(C)(C)C)C1CCC1 |
| InChI | InChI=1S/C25H39NO3Si/c1-8-19(2)22-25(21-15-12-16-21,18-28-30(6,7)24(3,4)5)26(23(27)29-22)17-20-13-10-9-11-14-20/h9-11,13-14,21-22H,2,8,12,15-18H2,1,3-7H3/t22-,25-/m1/s1 |
| InChIKey | NEAWPAHBQXOWLE-RCZVLFRGSA-N |
| XLogP | 6.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.68 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|