C21H15N3O8 — CID 11373982
dimethyl 3-(4-nitrobenzoyl)-5-oxo-2H-pyrazolo[5,1-a]isoindole-1,2-dicarboxylate (PubChem CID 11373982) has the molecular formula C21H15N3O8 and a molecular weight of 437.36 g/mol. Its IUPAC name is dimethyl 3-(4-nitrobenzoyl)-5-oxo-2H-pyrazolo[5,1-a]isoindole-1,2-dicarboxylate.
| Compound Name | dimethyl 3-(4-nitrobenzoyl)-5-oxo-2H-pyrazolo[5,1-a]isoindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11373982 |
| Molecular Formula | C21H15N3O8 |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | dimethyl 3-(4-nitrobenzoyl)-5-oxo-2H-pyrazolo[5,1-a]isoindole-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C2c3ccccc3C(=O)N2N(C(=O)c2ccc([N+](=O)[O-])cc2)C1C(=O)OC |
| InChI | InChI=1S/C21H15N3O8/c1-31-20(27)15-16-13-5-3-4-6-14(13)19(26)22(16)23(17(15)21(28)32-2)18(25)11-7-9-12(10-8-11)24(29)30/h3-10,17H,1-2H3 |
| InChIKey | OZVARXAHPRWZKT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 136.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|