C31H33N3O2 — CID 11375032
(E)-N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-benzylpiperidin-3-yl)-3-phenylprop-2-enamide (PubChem CID 11375032) has the molecular formula C31H33N3O2 and a molecular weight of 479.62 g/mol. Its IUPAC name is (E)-N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-benzylpiperidin-3-yl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-benzylpiperidin-3-yl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 11375032 |
| Molecular Formula | C31H33N3O2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | (E)-N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-benzylpiperidin-3-yl)-3-phenylprop-2-enamide |
| SMILES | CC(=O)N1CCc2ccc(N(C(=O)/C=C/c3ccccc3)C3CCCN(Cc4ccccc4)C3)cc21 |
| InChI | InChI=1S/C31H33N3O2/c1-24(35)33-20-18-27-15-16-28(21-30(27)33)34(31(36)17-14-25-9-4-2-5-10-25)29-13-8-19-32(23-29)22-26-11-6-3-7-12-26/h2-7,9-12,14-17,21,29H,8,13,18-20,22-23H2,1H3/b17-14+ |
| InChIKey | XQGXCFPHZVHVIS-SAPNQHFASA-N |
| XLogP | 5.31 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|