C33H35N3O2 — CID 72798995
N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-benzylpiperidin-4-yl)-5-phenylpenta-2,4-dienamide (PubChem CID 72798995) has the molecular formula C33H35N3O2 and a molecular weight of 505.66 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-benzylpiperidin-4-yl)-5-phenylpenta-2,4-dienamide.
| Compound Name | N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-benzylpiperidin-4-yl)-5-phenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 72798995 |
| Molecular Formula | C33H35N3O2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-benzylpiperidin-4-yl)-5-phenylpenta-2,4-dienamide |
| SMILES | CC(=O)N1CCc2ccc(N(C(=O)C=CC=Cc3ccccc3)C3CCN(Cc4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C33H35N3O2/c1-26(37)35-23-18-29-16-17-31(24-32(29)35)36(33(38)15-9-8-12-27-10-4-2-5-11-27)30-19-21-34(22-20-30)25-28-13-6-3-7-14-28/h2-17,24,30H,18-23,25H2,1H3 |
| InChIKey | JPRXROIKMOJKFY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|