C31H40N3O2+ — CID 69231819
N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-cyclohexyl-1-methylpiperidin-1-ium-4-yl)-3-phenylprop-2-enamide (PubChem CID 69231819) has the molecular formula C31H40N3O2+ and a molecular weight of 486.68 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-cyclohexyl-1-methylpiperidin-1-ium-4-yl)-3-phenylprop-2-enamide.
| Compound Name | N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-cyclohexyl-1-methylpiperidin-1-ium-4-yl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 69231819 |
| Molecular Formula | C31H40N3O2+ |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-cyclohexyl-1-methylpiperidin-1-ium-4-yl)-3-phenylprop-2-enamide |
| SMILES | CC(=O)N1CCc2ccc(N(C(=O)C=Cc3ccccc3)C3CC[N+](C)(C4CCCCC4)CC3)cc21 |
| InChI | InChI=1S/C31H40N3O2/c1-24(35)32-20-17-26-14-15-28(23-30(26)32)33(31(36)16-13-25-9-5-3-6-10-25)27-18-21-34(2,22-19-27)29-11-7-4-8-12-29/h3,5-6,9-10,13-16,23,27,29H,4,7-8,11-12,17-22H2,1-2H3/q+1 |
| InChIKey | LUXWEFPTOFFJPF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|