C29H30N3ORb — CID 59641766
(E)-N-(1-benzylpiperidin-4-yl)-N-(2,3-dihydroindol-1-id-6-yl)-3-phenylprop-2-enamide;rubidium(1+) (PubChem CID 59641766) has the molecular formula C29H30N3ORb and a molecular weight of 522.05 g/mol. Its IUPAC name is (E)-N-(1-benzylpiperidin-4-yl)-N-(2,3-dihydroindol-1-id-6-yl)-3-phenylprop-2-enamide;rubidium(1+).
| Compound Name | (E)-N-(1-benzylpiperidin-4-yl)-N-(2,3-dihydroindol-1-id-6-yl)-3-phenylprop-2-enamide;rubidium(1+) |
|---|---|
| PubChem CID | 59641766 |
| Molecular Formula | C29H30N3ORb |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | (E)-N-(1-benzylpiperidin-4-yl)-N-(2,3-dihydroindol-1-id-6-yl)-3-phenylprop-2-enamide;rubidium(1+) |
| SMILES | O=C(/C=C/c1ccccc1)N(c1ccc2c(c1)[N-]CC2)C1CCN(Cc2ccccc2)CC1.[Rb+] |
| InChI | InChI=1S/C29H30N3O.Rb/c33-29(14-11-23-7-3-1-4-8-23)32(27-13-12-25-15-18-30-28(25)21-27)26-16-19-31(20-17-26)22-24-9-5-2-6-10-24;/h1-14,21,26H,15-20,22H2;/q-1;+1/b14-11+; |
| InChIKey | KKYCAWCIUCJHDA-JHGYPSGKSA-N |
| XLogP | 2.96 |
| TPSA | 37.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|