C31H31F2N3O2 — CID 69208891
N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-benzylpiperidin-4-yl)-3-(3,5-difluorophenyl)prop-2-enamide (PubChem CID 69208891) has the molecular formula C31H31F2N3O2 and a molecular weight of 515.60 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-benzylpiperidin-4-yl)-3-(3,5-difluorophenyl)prop-2-enamide.
| Compound Name | N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-benzylpiperidin-4-yl)-3-(3,5-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 69208891 |
| Molecular Formula | C31H31F2N3O2 |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-6-yl)-N-(1-benzylpiperidin-4-yl)-3-(3,5-difluorophenyl)prop-2-enamide |
| SMILES | CC(=O)N1CCc2ccc(N(C(=O)C=Cc3cc(F)cc(F)c3)C3CCN(Cc4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C31H31F2N3O2/c1-22(37)35-16-11-25-8-9-29(20-30(25)35)36(31(38)10-7-24-17-26(32)19-27(33)18-24)28-12-14-34(15-13-28)21-23-5-3-2-4-6-23/h2-10,17-20,28H,11-16,21H2,1H3 |
| InChIKey | BYTPIWAFSDSLDV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|