C31H36N2O5 — CID 11375768
(2R,3aR,4R,5R,6R)-N,N-dimethyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxamide (PubChem CID 11375768) has the molecular formula C31H36N2O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is (2R,3aR,4R,5R,6R)-N,N-dimethyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxamide.
| Compound Name | (2R,3aR,4R,5R,6R)-N,N-dimethyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxamide |
|---|---|
| PubChem CID | 11375768 |
| Molecular Formula | C31H36N2O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | (2R,3aR,4R,5R,6R)-N,N-dimethyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1C[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)N2O1 |
| InChI | InChI=1S/C31H36N2O5/c1-32(2)31(34)28-18-26-29(36-20-24-14-8-4-9-15-24)30(37-21-25-16-10-5-11-17-25)27(33(26)38-28)22-35-19-23-12-6-3-7-13-23/h3-17,26-30H,18-22H2,1-2H3/t26-,27-,28-,29-,30-/m1/s1 |
| InChIKey | MWORMEVDXVMXOG-XZTOTZIXSA-N |
| XLogP | 4.22 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |