C31H47NO3Si2 — CID 11376099
6-[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2,2,4-trimethyl-1H-quinoline-5-carbaldehyde (PubChem CID 11376099) has the molecular formula C31H47NO3Si2 and a molecular weight of 537.89 g/mol. Its IUPAC name is 6-[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2,2,4-trimethyl-1H-quinoline-5-carbaldehyde.
| Compound Name | 6-[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2,2,4-trimethyl-1H-quinoline-5-carbaldehyde |
|---|---|
| PubChem CID | 11376099 |
| Molecular Formula | C31H47NO3Si2 |
| Molecular Weight | 537.89 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | 6-[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-2,2,4-trimethyl-1H-quinoline-5-carbaldehyde |
| SMILES | CC1=CC(C)(C)Nc2ccc(-c3c(O[Si](C)(C)C(C)(C)C)cccc3O[Si](C)(C)C(C)(C)C)c(C=O)c21 |
| InChI | InChI=1S/C31H47NO3Si2/c1-21-19-31(8,9)32-24-18-17-22(23(20-33)27(21)24)28-25(34-36(10,11)29(2,3)4)15-14-16-26(28)35-37(12,13)30(5,6)7/h14-20,32H,1-13H3 |
| InChIKey | ZBEFAWZCHYOLTF-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.89 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|