C33H44N2O6 — CID 11376466
benzyl (6S)-6-[(2R)-2-[4,4-diethoxybutyl(phenylmethoxycarbonyl)amino]but-3-enyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 11376466) has the molecular formula C33H44N2O6 and a molecular weight of 564.72 g/mol. Its IUPAC name is benzyl (6S)-6-[(2R)-2-[4,4-diethoxybutyl(phenylmethoxycarbonyl)amino]but-3-enyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | benzyl (6S)-6-[(2R)-2-[4,4-diethoxybutyl(phenylmethoxycarbonyl)amino]but-3-enyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 11376466 |
| Molecular Formula | C33H44N2O6 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | benzyl (6S)-6-[(2R)-2-[4,4-diethoxybutyl(phenylmethoxycarbonyl)amino]but-3-enyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=C[C@@H](C[C@H]1C=CCCN1C(=O)OCc1ccccc1)N(CCCC(OCC)OCC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H44N2O6/c1-4-29(24-30-20-13-14-22-35(30)33(37)41-26-28-18-11-8-12-19-28)34(23-15-21-31(38-5-2)39-6-3)32(36)40-25-27-16-9-7-10-17-27/h4,7-13,16-20,29-31H,1,5-6,14-15,21-26H2,2-3H3/t29-,30+/m0/s1 |
| InChIKey | CRAVTANPPYAZJM-XZWHSSHBSA-N |
| XLogP | 6.72 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|