C27H31NO4 — CID 11112872
ethyl (6S)-6-[(1S,2S)-1,2-bis(phenylmethoxy)pent-3-ynyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 11112872) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is ethyl (6S)-6-[(1S,2S)-1,2-bis(phenylmethoxy)pent-3-ynyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | ethyl (6S)-6-[(1S,2S)-1,2-bis(phenylmethoxy)pent-3-ynyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 11112872 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | ethyl (6S)-6-[(1S,2S)-1,2-bis(phenylmethoxy)pent-3-ynyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC#C[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H]1C=CCCN1C(=O)OCC |
| InChI | InChI=1S/C27H31NO4/c1-3-13-25(31-20-22-14-7-5-8-15-22)26(32-21-23-16-9-6-10-17-23)24-18-11-12-19-28(24)27(29)30-4-2/h5-11,14-18,24-26H,4,12,19-21H2,1-2H3/t24-,25-,26-/m0/s1 |
| InChIKey | UBXYDYWRMZJAKS-GSDHBNRESA-N |
| XLogP | 4.97 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|