C32H35N3O5S — CID 11376585
1,3-dibenzyl-8-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-1,3-diazaspiro[4.4]non-7-ene-2,4-dione (PubChem CID 11376585) has the molecular formula C32H35N3O5S and a molecular weight of 573.72 g/mol. Its IUPAC name is 1,3-dibenzyl-8-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-1,3-diazaspiro[4.4]non-7-ene-2,4-dione.
| Compound Name | 1,3-dibenzyl-8-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-1,3-diazaspiro[4.4]non-7-ene-2,4-dione |
|---|---|
| PubChem CID | 11376585 |
| Molecular Formula | C32H35N3O5S |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 1,3-dibenzyl-8-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-1,3-diazaspiro[4.4]non-7-ene-2,4-dione |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS(=O)(=O)N(C(=O)C1=CCC4(C1)C(=O)N(Cc1ccccc1)C(=O)N4Cc1ccccc1)[C@@H]3C2 |
| InChI | InChI=1S/C32H35N3O5S/c1-30(2)25-14-15-31(30)21-41(39,40)35(26(31)17-25)27(36)24-13-16-32(18-24)28(37)33(19-22-9-5-3-6-10-22)29(38)34(32)20-23-11-7-4-8-12-23/h3-13,25-26H,14-21H2,1-2H3/t25-,26-,31-,32?/m1/s1 |
| InChIKey | QKVXSNATORKLOE-USOKPPOPSA-N |
| XLogP | 4.48 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|