C54H38F6N2O6S2 — CID 11378134
bis(trifluoromethanesulfonate);1,2,6-triphenyl-4-[4-(1,2,6-triphenylpyridin-1-ium-4-yl)phenyl]pyridin-1-ium (PubChem CID 11378134) has the molecular formula C54H38F6N2O6S2 and a molecular weight of 989.03 g/mol. Its IUPAC name is bis(trifluoromethanesulfonate);1,2,6-triphenyl-4-[4-(1,2,6-triphenylpyridin-1-ium-4-yl)phenyl]pyridin-1-ium.
| Compound Name | bis(trifluoromethanesulfonate);1,2,6-triphenyl-4-[4-(1,2,6-triphenylpyridin-1-ium-4-yl)phenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 11378134 |
| Molecular Formula | C54H38F6N2O6S2 |
| Molecular Weight | 989.03 g/mol |
| Exact Mass | 988.21 |
| IUPAC Name | bis(trifluoromethanesulfonate);1,2,6-triphenyl-4-[4-(1,2,6-triphenylpyridin-1-ium-4-yl)phenyl]pyridin-1-ium |
| SMILES | O=S(=O)([O-])C(F)(F)F.O=S(=O)([O-])C(F)(F)F.c1ccc(-c2cc(-c3ccc(-c4cc(-c5ccccc5)[n+](-c5ccccc5)c(-c5ccccc5)c4)cc3)cc(-c3ccccc3)[n+]2-c2ccccc2)cc1 |
| InChI | InChI=1S/C52H38N2.2CHF3O3S/c1-7-19-41(20-8-1)49-35-45(36-50(42-21-9-2-10-22-42)53(49)47-27-15-5-16-28-47)39-31-33-40(34-32-39)46-37-51(43-23-11-3-12-24-43)54(48-29-17-6-18-30-48)52(38-46)44-25-13-4-14-26-44;2*2-1(3,4)8(5,6)7/h1-38H;2*(H,5,6,7)/q+2;;/p-2 |
| InChIKey | NQFJBAHUKVFQKW-UHFFFAOYSA-L |
| XLogP | 12.34 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 989.03 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|