C17H30OSi — CID 11380431
(4S,5R)-3,4,5-trimethyl-4-[(Z)-5-trimethylsilylpent-3-enyl]cyclohex-2-en-1-one (PubChem CID 11380431) has the molecular formula C17H30OSi and a molecular weight of 278.51 g/mol. Its IUPAC name is (4S,5R)-3,4,5-trimethyl-4-[(Z)-5-trimethylsilylpent-3-enyl]cyclohex-2-en-1-one.
| Compound Name | (4S,5R)-3,4,5-trimethyl-4-[(Z)-5-trimethylsilylpent-3-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11380431 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | (4S,5R)-3,4,5-trimethyl-4-[(Z)-5-trimethylsilylpent-3-enyl]cyclohex-2-en-1-one |
| SMILES | CC1=CC(=O)C[C@@H](C)[C@]1(C)CC/C=C\C[Si](C)(C)C |
| InChI | InChI=1S/C17H30OSi/c1-14-12-16(18)13-15(2)17(14,3)10-8-7-9-11-19(4,5)6/h7,9,12,15H,8,10-11,13H2,1-6H3/b9-7-/t15-,17-/m1/s1 |
| InChIKey | KQLZWOIVEVTUSF-ZKVFWIFDSA-N |
| XLogP | 5.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|