C17H18F3NO2 — CID 11381767
benzyl N-but-2-ynyl-N-(1,1,1-trifluoropent-4-en-2-yl)carbamate (PubChem CID 11381767) has the molecular formula C17H18F3NO2 and a molecular weight of 325.33 g/mol. Its IUPAC name is benzyl N-but-2-ynyl-N-(1,1,1-trifluoropent-4-en-2-yl)carbamate.
| Compound Name | benzyl N-but-2-ynyl-N-(1,1,1-trifluoropent-4-en-2-yl)carbamate |
|---|---|
| PubChem CID | 11381767 |
| Molecular Formula | C17H18F3NO2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | benzyl N-but-2-ynyl-N-(1,1,1-trifluoropent-4-en-2-yl)carbamate |
| SMILES | C=CCC(N(CC#CC)C(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H18F3NO2/c1-3-5-12-21(15(9-4-2)17(18,19)20)16(22)23-13-14-10-7-6-8-11-14/h4,6-8,10-11,15H,2,9,12-13H2,1H3 |
| InChIKey | USXFLNMTCKLLCM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|