C17H23BrO2 — CID 11382198
(1S,8R,11R)-11-[(E)-4-bromo-3-methylbut-2-enyl]-8-hydroxy-11-methyltricyclo[6.2.1.01,5]undec-5-en-7-one (PubChem CID 11382198) has the molecular formula C17H23BrO2 and a molecular weight of 339.27 g/mol. Its IUPAC name is (1S,8R,11R)-11-[(E)-4-bromo-3-methylbut-2-enyl]-8-hydroxy-11-methyltricyclo[6.2.1.01,5]undec-5-en-7-one.
| Compound Name | (1S,8R,11R)-11-[(E)-4-bromo-3-methylbut-2-enyl]-8-hydroxy-11-methyltricyclo[6.2.1.01,5]undec-5-en-7-one |
|---|---|
| PubChem CID | 11382198 |
| Molecular Formula | C17H23BrO2 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (1S,8R,11R)-11-[(E)-4-bromo-3-methylbut-2-enyl]-8-hydroxy-11-methyltricyclo[6.2.1.01,5]undec-5-en-7-one |
| SMILES | C/C(=C\C[C@]1(C)[C@]23CCCC2=CC(=O)[C@@]1(O)CC3)CBr |
| InChI | InChI=1S/C17H23BrO2/c1-12(11-18)5-7-15(2)16-6-3-4-13(16)10-14(19)17(15,20)9-8-16/h5,10,20H,3-4,6-9,11H2,1-2H3/b12-5+/t15-,16+,17+/m1/s1 |
| InChIKey | SCLKFKORJHVWJT-OTVMEHRQSA-N |
| XLogP | 3.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|