C14H10N2O3 — CID 11391152
2-diazo-3,8-dimethoxyacenaphthylen-1-one (PubChem CID 11391152) has the molecular formula C14H10N2O3 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-diazo-3,8-dimethoxyacenaphthylen-1-one.
| Compound Name | 2-diazo-3,8-dimethoxyacenaphthylen-1-one |
|---|---|
| PubChem CID | 11391152 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-diazo-3,8-dimethoxyacenaphthylen-1-one |
| SMILES | COc1ccc2ccc(OC)c3c2c1C(=O)C3=[N+]=[N-] |
| InChI | InChI=1S/C14H10N2O3/c1-18-8-5-3-7-4-6-9(19-2)12-10(7)11(8)13(16-15)14(12)17/h3-6H,1-2H3 |
| InChIKey | HGBUIFRGNRFNIB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|